C40H42N4O5 — CID 175804076
9H-fluoren-9-ylmethyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[3-(methylamino)azetidin-1-yl]-1-oxohexan-2-yl]carbamate (PubChem CID 175804076) has the molecular formula C40H42N4O5 and a molecular weight of 658.80 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[3-(methylamino)azetidin-1-yl]-1-oxohexan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[3-(methylamino)azetidin-1-yl]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 175804076 |
| Molecular Formula | C40H42N4O5 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.32 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[3-(methylamino)azetidin-1-yl]-1-oxohexan-2-yl]carbamate |
| SMILES | CNC1CN(C(=O)[C@H](CCCCNC(=O)OCC2c3ccccc3-c3ccccc32)NC(=O)OCC2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C40H42N4O5/c1-41-26-22-44(23-26)38(45)37(43-40(47)49-25-36-33-18-8-4-14-29(33)30-15-5-9-19-34(30)36)20-10-11-21-42-39(46)48-24-35-31-16-6-2-12-27(31)28-13-3-7-17-32(28)35/h2-9,12-19,26,35-37,41H,10-11,20-25H2,1H3,(H,42,46)(H,43,47)/t37-/m0/s1 |
| InChIKey | JIIBGVHHEHEFIJ-QNGWXLTQSA-N |
| XLogP | 6.03 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|