C24H20NNaO8S — CID 91884902
sodium (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-sulfooxyphenyl)propanoate (PubChem CID 91884902) has the molecular formula C24H20NNaO8S and a molecular weight of 505.48 g/mol. Its IUPAC name is sodium (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-sulfooxyphenyl)propanoate.
| Compound Name | sodium (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-sulfooxyphenyl)propanoate |
|---|---|
| PubChem CID | 91884902 |
| Molecular Formula | C24H20NNaO8S |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | sodium (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-sulfooxyphenyl)propanoate |
| SMILES | O=C(N[C@@H](Cc1ccc(OS(=O)(=O)O)cc1)C(=O)[O-])OCC1c2ccccc2-c2ccccc21.[Na+] |
| InChI | InChI=1S/C24H21NO8S.Na/c26-23(27)22(13-15-9-11-16(12-10-15)33-34(29,30)31)25-24(28)32-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21;/h1-12,21-22H,13-14H2,(H,25,28)(H,26,27)(H,29,30,31);/q;+1/p-1/t22-;/m0./s1 |
| InChIKey | WSZCHQPWBPMXJT-FTBISJDPSA-M |
| XLogP | -0.93 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|