C24H18Cl2NO4- — CID 7020436
(2S)-3-(3,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 7020436) has the molecular formula C24H18Cl2NO4- and a molecular weight of 455.32 g/mol. Its IUPAC name is (2S)-3-(3,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | (2S)-3-(3,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 7020436 |
| Molecular Formula | C24H18Cl2NO4- |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | (2S)-3-(3,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | O=C(N[C@@H](Cc1ccc(Cl)c(Cl)c1)C(=O)[O-])OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H19Cl2NO4/c25-20-10-9-14(11-21(20)26)12-22(23(28)29)27-24(30)31-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-11,19,22H,12-13H2,(H,27,30)(H,28,29)/p-1/t22-/m0/s1 |
| InChIKey | QNVHCYWPXIGFGN-QFIPXVFZSA-M |
| XLogP | 4.19 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |