C22H18NO4S- — CID 7017917
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoate (PubChem CID 7017917) has the molecular formula C22H18NO4S- and a molecular weight of 392.46 g/mol. Its IUPAC name is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoate.
| Compound Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 7017917 |
| Molecular Formula | C22H18NO4S- |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoate |
| SMILES | O=C(N[C@H](Cc1cccs1)C(=O)[O-])OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H19NO4S/c24-21(25)20(12-14-6-5-11-28-14)23-22(26)27-13-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-11,19-20H,12-13H2,(H,23,26)(H,24,25)/p-1/t20-/m1/s1 |
| InChIKey | PXBMQFMUHRNKTG-HXUWFJFHSA-M |
| XLogP | 2.95 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |