C29H25NO4S — CID 170882739
3-(5-benzylthiophen-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 170882739) has the molecular formula C29H25NO4S and a molecular weight of 483.59 g/mol. Its IUPAC name is 3-(5-benzylthiophen-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(5-benzylthiophen-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 170882739 |
| Molecular Formula | C29H25NO4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 3-(5-benzylthiophen-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1ccc(Cc2ccccc2)s1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H25NO4S/c31-28(32)27(17-21-15-14-20(35-21)16-19-8-2-1-3-9-19)30-29(33)34-18-26-24-12-6-4-10-22(24)23-11-5-7-13-25(23)26/h1-15,26-27H,16-18H2,(H,30,33)(H,31,32) |
| InChIKey | ADAFFWJXELJJPC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |