C30H25N3O4 — CID 15838972
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenyldiazenylphenyl)propanoic acid (PubChem CID 15838972) has the molecular formula C30H25N3O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenyldiazenylphenyl)propanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenyldiazenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 15838972 |
| Molecular Formula | C30H25N3O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenyldiazenylphenyl)propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(/N=N/c2ccccc2)cc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H25N3O4/c34-29(35)28(18-20-14-16-22(17-15-20)33-32-21-8-2-1-3-9-21)31-30(36)37-19-27-25-12-6-4-10-23(25)24-11-5-7-13-26(24)27/h1-17,27-28H,18-19H2,(H,31,36)(H,34,35)/b33-32+/t28-/m0/s1 |
| InChIKey | QQPZDFDQHVDWMQ-JAVXYERYSA-N |
| XLogP | 6.64 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|