C38H34N4O4 — CID 170328619
3-[4-(diaminomethylideneamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;7-phenylbicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 170328619) has the molecular formula C38H34N4O4 and a molecular weight of 610.71 g/mol. Its IUPAC name is 3-[4-(diaminomethylideneamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;7-phenylbicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 3-[4-(diaminomethylideneamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;7-phenylbicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 170328619 |
| Molecular Formula | C38H34N4O4 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 3-[4-(diaminomethylideneamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;7-phenylbicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | NC(N)=Nc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1.c1ccc(C2c3ccccc32)cc1 |
| InChI | InChI=1S/C25H24N4O4.C13H10/c26-24(27)28-16-11-9-15(10-12-16)13-22(23(30)31)29-25(32)33-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21;1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)13/h1-12,21-22H,13-14H2,(H,29,32)(H,30,31)(H4,26,27,28);1-9,13H |
| InChIKey | SOMMVAAYPFXHLP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|