C24H24N2O4S — CID 170882961
3-[5-(dimethylamino)thiophen-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 170882961) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 3-[5-(dimethylamino)thiophen-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[5-(dimethylamino)thiophen-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 170882961 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-[5-(dimethylamino)thiophen-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CN(C)c1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)s1 |
| InChI | InChI=1S/C24H24N2O4S/c1-26(2)22-12-11-15(31-22)13-21(23(27)28)25-24(29)30-14-20-18-9-5-3-7-16(18)17-8-4-6-10-19(17)20/h3-12,20-21H,13-14H2,1-2H3,(H,25,29)(H,27,28) |
| InChIKey | NWWLMILLCZWMDB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |