C18H15NNa2O7S2 — CID 91825812
disodium;(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfonatosulfanylpropanoate (PubChem CID 91825812) has the molecular formula C18H15NNa2O7S2 and a molecular weight of 467.43 g/mol. Its IUPAC name is disodium;(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfonatosulfanylpropanoate.
| Compound Name | disodium;(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfonatosulfanylpropanoate |
|---|---|
| PubChem CID | 91825812 |
| Molecular Formula | C18H15NNa2O7S2 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | disodium;(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-sulfonatosulfanylpropanoate |
| SMILES | O=C(N[C@@H](CSS(=O)(=O)[O-])C(=O)[O-])OCC1c2ccccc2-c2ccccc21.[Na+].[Na+] |
| InChI | InChI=1S/C18H17NO7S2.2Na/c20-17(21)16(10-27-28(23,24)25)19-18(22)26-9-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15;;/h1-8,15-16H,9-10H2,(H,19,22)(H,20,21)(H,23,24,25);;/q;2*+1/p-2/t16-;;/m0../s1 |
| InChIKey | BIPPKCSTYKCFHX-SQKCAUCHSA-L |
| XLogP | -5.16 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|