C21H18FNO3S — CID 11199940
4-fluoro-N-[(4-methylphenyl)sulfonyl-phenylmethyl]benzamide (PubChem CID 11199940) has the molecular formula C21H18FNO3S and a molecular weight of 383.44 g/mol. Its IUPAC name is 4-fluoro-N-[(4-methylphenyl)sulfonyl-phenylmethyl]benzamide.
| Compound Name | 4-fluoro-N-[(4-methylphenyl)sulfonyl-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 11199940 |
| Molecular Formula | C21H18FNO3S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 4-fluoro-N-[(4-methylphenyl)sulfonyl-phenylmethyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)C(NC(=O)c2ccc(F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18FNO3S/c1-15-7-13-19(14-8-15)27(25,26)21(17-5-3-2-4-6-17)23-20(24)16-9-11-18(22)12-10-16/h2-14,21H,1H3,(H,23,24) |
| InChIKey | CYQUSLOLXOCUOI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |