C22H26N4O6 — CID 87926871
N-cyano-N-ethyl-3-(4-hydroxyphenyl)-2-[(3,4,5-trimethoxyphenyl)carbamoylamino]propanamide (PubChem CID 87926871) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is N-cyano-N-ethyl-3-(4-hydroxyphenyl)-2-[(3,4,5-trimethoxyphenyl)carbamoylamino]propanamide.
| Compound Name | N-cyano-N-ethyl-3-(4-hydroxyphenyl)-2-[(3,4,5-trimethoxyphenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 87926871 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-cyano-N-ethyl-3-(4-hydroxyphenyl)-2-[(3,4,5-trimethoxyphenyl)carbamoylamino]propanamide |
| SMILES | CCN(C#N)C(=O)C(Cc1ccc(O)cc1)NC(=O)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H26N4O6/c1-5-26(13-23)21(28)17(10-14-6-8-16(27)9-7-14)25-22(29)24-15-11-18(30-2)20(32-4)19(12-15)31-3/h6-9,11-12,17,27H,5,10H2,1-4H3,(H2,24,25,29) |
| InChIKey | SZAMZCXFUDVILS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|