C25H24N4O4 — CID 87927796
N-cyano-N-ethyl-3-(4-hydroxyphenyl)-2-[(4-phenoxyphenyl)carbamoylamino]propanamide (PubChem CID 87927796) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-cyano-N-ethyl-3-(4-hydroxyphenyl)-2-[(4-phenoxyphenyl)carbamoylamino]propanamide.
| Compound Name | N-cyano-N-ethyl-3-(4-hydroxyphenyl)-2-[(4-phenoxyphenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 87927796 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-cyano-N-ethyl-3-(4-hydroxyphenyl)-2-[(4-phenoxyphenyl)carbamoylamino]propanamide |
| SMILES | CCN(C#N)C(=O)C(Cc1ccc(O)cc1)NC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N4O4/c1-2-29(17-26)24(31)23(16-18-8-12-20(30)13-9-18)28-25(32)27-19-10-14-22(15-11-19)33-21-6-4-3-5-7-21/h3-15,23,30H,2,16H2,1H3,(H2,27,28,32) |
| InChIKey | NQKXILPMJVUDFD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|