C15H16N4O3 — CID 87926752
cyanomethyl N-[1-[cyano(ethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 87926752) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is cyanomethyl N-[1-[cyano(ethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | cyanomethyl N-[1-[cyano(ethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87926752 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | cyanomethyl N-[1-[cyano(ethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCN(C#N)C(=O)C(Cc1ccccc1)NC(=O)OCC#N |
| InChI | InChI=1S/C15H16N4O3/c1-2-19(11-17)14(20)13(18-15(21)22-9-8-16)10-12-6-4-3-5-7-12/h3-7,13H,2,9-10H2,1H3,(H,18,21) |
| InChIKey | OZJSUZHDFQVWNI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|