C23H23N3O4S — CID 87927472
N-cyano-N-ethyl-2-[(4-methoxyphenyl)sulfonylamino]-3-naphthalen-2-ylpropanamide (PubChem CID 87927472) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is N-cyano-N-ethyl-2-[(4-methoxyphenyl)sulfonylamino]-3-naphthalen-2-ylpropanamide.
| Compound Name | N-cyano-N-ethyl-2-[(4-methoxyphenyl)sulfonylamino]-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 87927472 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-cyano-N-ethyl-2-[(4-methoxyphenyl)sulfonylamino]-3-naphthalen-2-ylpropanamide |
| SMILES | CCN(C#N)C(=O)C(Cc1ccc2ccccc2c1)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-3-26(16-24)23(27)22(15-17-8-9-18-6-4-5-7-19(18)14-17)25-31(28,29)21-12-10-20(30-2)11-13-21/h4-14,22,25H,3,15H2,1-2H3 |
| InChIKey | ZIBGMWWVKPDSAE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|