C20H21N3O3 — CID 87927230
but-3-enyl N-[1-[cyano(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate (PubChem CID 87927230) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is but-3-enyl N-[1-[cyano(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate.
| Compound Name | but-3-enyl N-[1-[cyano(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87927230 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | but-3-enyl N-[1-[cyano(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate |
| SMILES | C=CCCOC(=O)NC(Cc1ccc2ccccc2c1)C(=O)N(C)C#N |
| InChI | InChI=1S/C20H21N3O3/c1-3-4-11-26-20(25)22-18(19(24)23(2)14-21)13-15-9-10-16-7-5-6-8-17(16)12-15/h3,5-10,12,18H,1,4,11,13H2,2H3,(H,22,25) |
| InChIKey | QAMXUIVAUNDGJX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|