C45H62N4O — CID 54567041
N-[4-(5-butylnonan-5-yl)phenyl]-3-naphthalen-2-yl-2-[[N-(3-phenylpropyl)-N'-propylcarbamimidoyl]amino]propanamide (PubChem CID 54567041) has the molecular formula C45H62N4O and a molecular weight of 675.02 g/mol. Its IUPAC name is N-[4-(5-butylnonan-5-yl)phenyl]-3-naphthalen-2-yl-2-[[N-(3-phenylpropyl)-N'-propylcarbamimidoyl]amino]propanamide.
| Compound Name | N-[4-(5-butylnonan-5-yl)phenyl]-3-naphthalen-2-yl-2-[[N-(3-phenylpropyl)-N'-propylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 54567041 |
| Molecular Formula | C45H62N4O |
| Molecular Weight | 675.02 g/mol |
| Exact Mass | 674.49 |
| IUPAC Name | N-[4-(5-butylnonan-5-yl)phenyl]-3-naphthalen-2-yl-2-[[N-(3-phenylpropyl)-N'-propylcarbamimidoyl]amino]propanamide |
| SMILES | CCCCC(CCCC)(CCCC)c1ccc(NC(=O)C(Cc2ccc3ccccc3c2)N/C(=N/CCC)NCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C45H62N4O/c1-5-9-29-45(30-10-6-2,31-11-7-3)40-25-27-41(28-26-40)48-43(50)42(35-37-23-24-38-21-15-16-22-39(38)34-37)49-44(46-32-8-4)47-33-17-20-36-18-13-12-14-19-36/h12-16,18-19,21-28,34,42H,5-11,17,20,29-33,35H2,1-4H3,(H,48,50)(H2,46,47,49) |
| InChIKey | ZUOTVFYXUDSFMF-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.02 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|