C17H15FN4O3 — CID 142753528
N-[(3S)-1-amino-1,2-dioxohex-5-yn-3-yl]-3-(2-fluorophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 142753528) has the molecular formula C17H15FN4O3 and a molecular weight of 342.33 g/mol. Its IUPAC name is N-[(3S)-1-amino-1,2-dioxohex-5-yn-3-yl]-3-(2-fluorophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[(3S)-1-amino-1,2-dioxohex-5-yn-3-yl]-3-(2-fluorophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142753528 |
| Molecular Formula | C17H15FN4O3 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-[(3S)-1-amino-1,2-dioxohex-5-yn-3-yl]-3-(2-fluorophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | C#CC[C@H](NC(=O)c1cn(C)nc1-c1ccccc1F)C(=O)C(N)=O |
| InChI | InChI=1S/C17H15FN4O3/c1-3-6-13(15(23)16(19)24)20-17(25)11-9-22(2)21-14(11)10-7-4-5-8-12(10)18/h1,4-5,7-9,13H,6H2,2H3,(H2,19,24)(H,20,25)/t13-/m0/s1 |
| InChIKey | KMTFIXDCYVFRNE-ZDUSSCGKSA-N |
| XLogP | 0.40 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|