C21H17F3N4O3 — CID 134397577
N-[4-amino-1-(3,5-difluorophenyl)-3,4-dioxobutan-2-yl]-3-(2-fluorophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 134397577) has the molecular formula C21H17F3N4O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is N-[4-amino-1-(3,5-difluorophenyl)-3,4-dioxobutan-2-yl]-3-(2-fluorophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[4-amino-1-(3,5-difluorophenyl)-3,4-dioxobutan-2-yl]-3-(2-fluorophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134397577 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[4-amino-1-(3,5-difluorophenyl)-3,4-dioxobutan-2-yl]-3-(2-fluorophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC(Cc2cc(F)cc(F)c2)C(=O)C(N)=O)c(-c2ccccc2F)n1 |
| InChI | InChI=1S/C21H17F3N4O3/c1-28-10-15(18(27-28)14-4-2-3-5-16(14)24)21(31)26-17(19(29)20(25)30)8-11-6-12(22)9-13(23)7-11/h2-7,9-10,17H,8H2,1H3,(H2,25,30)(H,26,31) |
| InChIKey | KZMNSMGOJOSICD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|