C25H23NO4 — CID 18690973
ethyl 2-oxo-4-phenyl-3-[(2-phenylbenzoyl)amino]butanoate (PubChem CID 18690973) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is ethyl 2-oxo-4-phenyl-3-[(2-phenylbenzoyl)amino]butanoate.
| Compound Name | ethyl 2-oxo-4-phenyl-3-[(2-phenylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 18690973 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | ethyl 2-oxo-4-phenyl-3-[(2-phenylbenzoyl)amino]butanoate |
| SMILES | CCOC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H23NO4/c1-2-30-25(29)23(27)22(17-18-11-5-3-6-12-18)26-24(28)21-16-10-9-15-20(21)19-13-7-4-8-14-19/h3-16,22H,2,17H2,1H3,(H,26,28) |
| InChIKey | JGOVNNDLKBGSNO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|