C28H30N2O4S — CID 71075001
1-[[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid (PubChem CID 71075001) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is 1-[[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid.
| Compound Name | 1-[[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 71075001 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 1-[[4-[2-(tert-butylsulfamoyl)phenyl]phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3S(=O)(=O)NC(C)(C)C)cc2)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C28H30N2O4S/c1-18-19(2)30(25-15-14-22(27(31)32)16-24(18)25)17-20-10-12-21(13-11-20)23-8-6-7-9-26(23)35(33,34)29-28(3,4)5/h6-16,29H,17H2,1-5H3,(H,31,32) |
| InChIKey | QMLXGQJJGLMJIL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|