C31H26N2O4 — CID 171467854
2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2-methylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 171467854) has the molecular formula C31H26N2O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2-methylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2-methylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 171467854 |
| Molecular Formula | C31H26N2O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2-methylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1cc2cc(C(=O)NCc3cccc(O)c3)ccc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H26N2O4/c1-20-15-25-17-24(30(35)32-18-22-5-4-6-26(34)16-22)13-14-29(25)33(20)19-21-9-11-23(12-10-21)27-7-2-3-8-28(27)31(36)37/h2-17,34H,18-19H2,1H3,(H,32,35)(H,36,37) |
| InChIKey | DFVOUDJGWAJQHC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |