C33H30N2O4 — CID 171467853
2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2-propylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 171467853) has the molecular formula C33H30N2O4 and a molecular weight of 518.61 g/mol. Its IUPAC name is 2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2-propylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2-propylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 171467853 |
| Molecular Formula | C33H30N2O4 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2-propylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCc1cc2cc(C(=O)NCc3cccc(O)c3)ccc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C33H30N2O4/c1-2-6-27-19-26-18-25(32(37)34-20-23-7-5-8-28(36)17-23)15-16-31(26)35(27)21-22-11-13-24(14-12-22)29-9-3-4-10-30(29)33(38)39/h3-5,7-19,36H,2,6,20-21H2,1H3,(H,34,37)(H,38,39) |
| InChIKey | LUGCZJWNKLHQPY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |