C21H15ClN2O2S — CID 87248784
N-[(4-chlorophenyl)-methyl-oxo-λ6-sulfanylidene]-5-(2-phenylethynyl)pyridine-3-carboxamide (PubChem CID 87248784) has the molecular formula C21H15ClN2O2S and a molecular weight of 394.88 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-methyl-oxo-λ6-sulfanylidene]-5-(2-phenylethynyl)pyridine-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)-methyl-oxo-λ6-sulfanylidene]-5-(2-phenylethynyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87248784 |
| Molecular Formula | C21H15ClN2O2S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-[(4-chlorophenyl)-methyl-oxo-λ6-sulfanylidene]-5-(2-phenylethynyl)pyridine-3-carboxamide |
| SMILES | CS(=O)(=NC(=O)c1cncc(C#Cc2ccccc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15ClN2O2S/c1-27(26,20-11-9-19(22)10-12-20)24-21(25)18-13-17(14-23-15-18)8-7-16-5-3-2-4-6-16/h2-6,9-15H,1H3 |
| InChIKey | OUGURZOGMSKIGL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|