C18H20N2O2SSi — CID 24953135
N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-(2-trimethylsilylethynyl)pyridine-3-carboxamide (PubChem CID 24953135) has the molecular formula C18H20N2O2SSi and a molecular weight of 356.52 g/mol. Its IUPAC name is N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-(2-trimethylsilylethynyl)pyridine-3-carboxamide.
| Compound Name | N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-(2-trimethylsilylethynyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24953135 |
| Molecular Formula | C18H20N2O2SSi |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-(2-trimethylsilylethynyl)pyridine-3-carboxamide |
| SMILES | C[Si](C)(C)C#Cc1cncc(C(=O)N=[S@@](C)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O2SSi/c1-23(22,17-8-6-5-7-9-17)20-18(21)16-12-15(13-19-14-16)10-11-24(2,3)4/h5-9,12-14H,1-4H3/t23-/m0/s1 |
| InChIKey | LLFIXDMGNGTHCS-QHCPKHFHSA-N |
| XLogP | 3.61 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|