C22H15F3N2O2S — CID 87165146
N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyridine-3-carboxamide (PubChem CID 87165146) has the molecular formula C22H15F3N2O2S and a molecular weight of 428.44 g/mol. Its IUPAC name is N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyridine-3-carboxamide.
| Compound Name | N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87165146 |
| Molecular Formula | C22H15F3N2O2S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-(methyl-oxo-phenyl-λ6-sulfanylidene)-5-[2-[4-(trifluoromethyl)phenyl]ethynyl]pyridine-3-carboxamide |
| SMILES | CS(=O)(=NC(=O)c1cncc(C#Cc2ccc(C(F)(F)F)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H15F3N2O2S/c1-30(29,20-5-3-2-4-6-20)27-21(28)18-13-17(14-26-15-18)8-7-16-9-11-19(12-10-16)22(23,24)25/h2-6,9-15H,1H3 |
| InChIKey | IVWGGGHHTGWXJJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|