C29H23N3O3S — CID 24952784
5-[2-[4-[(4-methylbenzoyl)amino]phenyl]ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide (PubChem CID 24952784) has the molecular formula C29H23N3O3S and a molecular weight of 493.59 g/mol. Its IUPAC name is 5-[2-[4-[(4-methylbenzoyl)amino]phenyl]ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide.
| Compound Name | 5-[2-[4-[(4-methylbenzoyl)amino]phenyl]ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24952784 |
| Molecular Formula | C29H23N3O3S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 5-[2-[4-[(4-methylbenzoyl)amino]phenyl]ethynyl]-N-(methyl-oxo-phenyl-λ6-sulfanylidene)pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C#Cc3cncc(C(=O)N=[S@@](C)(=O)c4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C29H23N3O3S/c1-21-8-14-24(15-9-21)28(33)31-26-16-12-22(13-17-26)10-11-23-18-25(20-30-19-23)29(34)32-36(2,35)27-6-4-3-5-7-27/h3-9,12-20H,1-2H3,(H,31,33)/t36-/m0/s1 |
| InChIKey | QDXVYTKUMHCXOO-BHVANESWSA-N |
| XLogP | 5.34 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|