C23H18ClN3O3S — CID 87165342
N-[(4-acetamidophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(4-chlorophenyl)ethynyl]pyridine-3-carboxamide (PubChem CID 87165342) has the molecular formula C23H18ClN3O3S and a molecular weight of 451.94 g/mol. Its IUPAC name is N-[(4-acetamidophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(4-chlorophenyl)ethynyl]pyridine-3-carboxamide.
| Compound Name | N-[(4-acetamidophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(4-chlorophenyl)ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87165342 |
| Molecular Formula | C23H18ClN3O3S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N-[(4-acetamidophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(4-chlorophenyl)ethynyl]pyridine-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(S(C)(=O)=NC(=O)c2cncc(C#Cc3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C23H18ClN3O3S/c1-16(28)26-21-9-11-22(12-10-21)31(2,30)27-23(29)19-13-18(14-25-15-19)4-3-17-5-7-20(24)8-6-17/h5-15H,1-2H3,(H,26,28) |
| InChIKey | RFTVDEFHANCRGK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|