C23H18BrN3O3S — CID 87165395
N-[(3-acetamidophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(2-bromophenyl)ethynyl]pyridine-3-carboxamide (PubChem CID 87165395) has the molecular formula C23H18BrN3O3S and a molecular weight of 496.39 g/mol. Its IUPAC name is N-[(3-acetamidophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(2-bromophenyl)ethynyl]pyridine-3-carboxamide.
| Compound Name | N-[(3-acetamidophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(2-bromophenyl)ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87165395 |
| Molecular Formula | C23H18BrN3O3S |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | N-[(3-acetamidophenyl)-methyl-oxo-λ6-sulfanylidene]-5-[2-(2-bromophenyl)ethynyl]pyridine-3-carboxamide |
| SMILES | CC(=O)Nc1cccc(S(C)(=O)=NC(=O)c2cncc(C#Cc3ccccc3Br)c2)c1 |
| InChI | InChI=1S/C23H18BrN3O3S/c1-16(28)26-20-7-5-8-21(13-20)31(2,30)27-23(29)19-12-17(14-25-15-19)10-11-18-6-3-4-9-22(18)24/h3-9,12-15H,1-2H3,(H,26,28) |
| InChIKey | JZDXUSXKBUHQEH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|