C16H14N4OS — CID 2822395
1-methyl-3-[[5-(2-phenylethynyl)pyridine-3-carbonyl]amino]thiourea (PubChem CID 2822395) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-methyl-3-[[5-(2-phenylethynyl)pyridine-3-carbonyl]amino]thiourea.
| Compound Name | 1-methyl-3-[[5-(2-phenylethynyl)pyridine-3-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 2822395 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-methyl-3-[[5-(2-phenylethynyl)pyridine-3-carbonyl]amino]thiourea |
| SMILES | CNC(=S)NNC(=O)c1cncc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H14N4OS/c1-17-16(22)20-19-15(21)14-9-13(10-18-11-14)8-7-12-5-3-2-4-6-12/h2-6,9-11H,1H3,(H,19,21)(H2,17,20,22) |
| InChIKey | NOLHAPDBJBRSBE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|