C23H20N2O4S — CID 91091847
5-[2-(3,5-dimethoxyphenyl)ethynyl]-N-(methylidene-oxo-phenyl-λ6-sulfanyl)pyridine-3-carboxamide (PubChem CID 91091847) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is 5-[2-(3,5-dimethoxyphenyl)ethynyl]-N-(methylidene-oxo-phenyl-λ6-sulfanyl)pyridine-3-carboxamide.
| Compound Name | 5-[2-(3,5-dimethoxyphenyl)ethynyl]-N-(methylidene-oxo-phenyl-λ6-sulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91091847 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 5-[2-(3,5-dimethoxyphenyl)ethynyl]-N-(methylidene-oxo-phenyl-λ6-sulfanyl)pyridine-3-carboxamide |
| SMILES | C=S(=O)(NC(=O)c1cncc(C#Cc2cc(OC)cc(OC)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O4S/c1-28-20-12-17(13-21(14-20)29-2)9-10-18-11-19(16-24-15-18)23(26)25-30(3,27)22-7-5-4-6-8-22/h4-8,11-16H,3H2,1-2H3,(H,25,26,27) |
| InChIKey | OQENXGUWZSRIAN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|