C23H20N2O3S — CID 91421725
5-[2-(3-methoxyphenyl)ethynyl]-N-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]pyridine-3-carboxamide (PubChem CID 91421725) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 5-[2-(3-methoxyphenyl)ethynyl]-N-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]pyridine-3-carboxamide.
| Compound Name | 5-[2-(3-methoxyphenyl)ethynyl]-N-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91421725 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 5-[2-(3-methoxyphenyl)ethynyl]-N-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]pyridine-3-carboxamide |
| SMILES | C=S(=O)(NC(=O)c1cncc(C#Cc2cccc(OC)c2)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H20N2O3S/c1-17-7-11-22(12-8-17)29(3,27)25-23(26)20-13-19(15-24-16-20)10-9-18-5-4-6-21(14-18)28-2/h4-8,11-16H,3H2,1-2H3,(H,25,26,27) |
| InChIKey | KDJISCSMQCZQIA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|