About 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid
2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid (PubChem CID 91499816) has the molecular formula C22H16N2O5S
and a molecular weight of 420.45 g/mol. Its IUPAC name is 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid |
| PubChem CID | 91499816 |
| Molecular Formula | C22H16N2O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid |
| SMILES | C=S(=O)(NC(=O)c1cncc(C#Cc2ccc(O)c(C(=O)O)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H16N2O5S/c1-30(29,18-5-3-2-4-6-18)24-21(26)17-11-16(13-23-14-17)8-7-15-9-10-20(25)19(12-15)22(27)28/h2-6,9-14,25H,1H2,(H,27,28)(H,24,26,29) |
| InChIKey | ASFSQSXVVQTNFO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid?
The IUPAC name of 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid (CID 91499816) is 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid.
What is the SMILES notation for 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid?
The canonical SMILES for 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid is C=S(=O)(NC(=O)c1cncc(C#Cc2ccc(O)c(C(=O)O)c2)c1)c1ccccc1.
What is the InChIKey of 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid?
The InChIKey is ASFSQSXVVQTNFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O5S/c1-30(29,18-5-3-2-4-6-18)24-21(26)17-11-16(13-23-14-17)8-7-15-9-10-20(25)19(12-15)22(27)28/h2-6,9-14,25H,1H2,(H,27,28)(H,24,26,29).
What are the key properties of 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid?
2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid has a molecular weight of 420.45 g/mol, XLogP of 2.31, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-[2-[5-[(methylidene-oxo-phenyl-λ6-sulfanyl)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid is sourced from PubChem (CID 91499816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).