C10H13N5O2S — CID 71756607
N-[5-[(methylcarbamothioylamino)carbamoyl]-3-pyridinyl]acetamide (PubChem CID 71756607) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is N-[5-[(methylcarbamothioylamino)carbamoyl]-3-pyridinyl]acetamide.
| Compound Name | N-[5-[(methylcarbamothioylamino)carbamoyl]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 71756607 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | N-[5-[(methylcarbamothioylamino)carbamoyl]-3-pyridinyl]acetamide |
| SMILES | CNC(=S)NNC(=O)c1cncc(NC(C)=O)c1 |
| InChI | InChI=1S/C10H13N5O2S/c1-6(16)13-8-3-7(4-12-5-8)9(17)14-15-10(18)11-2/h3-5H,1-2H3,(H,13,16)(H,14,17)(H2,11,15,18) |
| InChIKey | OYMSBGSYMSRNFT-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|