C18H16ClF3N2O2 — CID 108953519
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(2,4-dimethylphenyl)propanediamide (PubChem CID 108953519) has the molecular formula C18H16ClF3N2O2 and a molecular weight of 384.79 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(2,4-dimethylphenyl)propanediamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(2,4-dimethylphenyl)propanediamide |
|---|---|
| PubChem CID | 108953519 |
| Molecular Formula | C18H16ClF3N2O2 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(2,4-dimethylphenyl)propanediamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C18H16ClF3N2O2/c1-10-3-6-15(11(2)7-10)24-17(26)9-16(25)23-12-4-5-14(19)13(8-12)18(20,21)22/h3-8H,9H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | VZKJURHAOXCMEF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|