C23H18F2N2O2S — CID 11487076
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-9-methyl-11-oxotricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9-carboxamide (PubChem CID 11487076) has the molecular formula C23H18F2N2O2S and a molecular weight of 424.47 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-9-methyl-11-oxotricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9-carboxamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-9-methyl-11-oxotricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9-carboxamide |
|---|---|
| PubChem CID | 11487076 |
| Molecular Formula | C23H18F2N2O2S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-9-methyl-11-oxotricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9-carboxamide |
| SMILES | CC1(C(=O)Nc2nc(-c3ccc(F)c(F)c3)cs2)CC2C(=O)CC1c1ccccc12 |
| InChI | InChI=1S/C23H18F2N2O2S/c1-23(10-15-13-4-2-3-5-14(13)16(23)9-20(15)28)21(29)27-22-26-19(11-30-22)12-6-7-17(24)18(25)8-12/h2-8,11,15-16H,9-10H2,1H3,(H,26,27,29) |
| InChIKey | CFEVRKYJRSDXLZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |