C20H23N3O3 — CID 20993307
2-[2-[2-[3-(dimethylamino)propoxy]phenyl]benzimidazol-1-yl]acetic acid (PubChem CID 20993307) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]benzimidazol-1-yl]acetic acid.
| Compound Name | 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]benzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 20993307 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]benzimidazol-1-yl]acetic acid |
| SMILES | CN(C)CCCOc1ccccc1-c1nc2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C20H23N3O3/c1-22(2)12-7-13-26-18-11-6-3-8-15(18)20-21-16-9-4-5-10-17(16)23(20)14-19(24)25/h3-6,8-11H,7,12-14H2,1-2H3,(H,24,25) |
| InChIKey | HOPUYCSEKRBQKU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|