2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid

C17H16N2O4 — CID 86717111

IUPAC2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid
SMILESCOc1ccc(OC)c(-c2nc3ccccc3n2CC(=O)O)c1
InChIInChI=1S/C17H16N2O4/c1-22-11-7-8-15(23-2)12(9-11)17-18-13-5-3-4-6-14(13)19(17)10-16(20)21/h3-9H,10H2,1-2H3,(H,20,21)
InChIKeyZYDZHSWMGZGYIO-UHFFFAOYSA-N
MW312.33 g/mol
LogP2.81
Rot. Bonds5

About 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid

2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid (PubChem CID 86717111) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid
PubChem CID86717111
Molecular FormulaC17H16N2O4
Molecular Weight312.33 g/mol
Exact Mass312.11
IUPAC Name2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid
SMILESCOc1ccc(OC)c(-c2nc3ccccc3n2CC(=O)O)c1
InChIInChI=1S/C17H16N2O4/c1-22-11-7-8-15(23-2)12(9-11)17-18-13-5-3-4-6-14(13)19(17)10-16(20)21/h3-9H,10H2,1-2H3,(H,20,21)
InChIKeyZYDZHSWMGZGYIO-UHFFFAOYSA-N
XLogP2.81
TPSA73.58 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.33
LogP ≤ 52.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid?
The IUPAC name of 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid (CID 86717111) is 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid.
What is the SMILES notation for 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid?
The canonical SMILES for 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid is COc1ccc(OC)c(-c2nc3ccccc3n2CC(=O)O)c1.
What is the InChIKey of 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid?
The InChIKey is ZYDZHSWMGZGYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O4/c1-22-11-7-8-15(23-2)12(9-11)17-18-13-5-3-4-6-14(13)19(17)10-16(20)21/h3-9H,10H2,1-2H3,(H,20,21).
What are the key properties of 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid?
2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid has a molecular weight of 312.33 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-dimethoxyphenyl)benzimidazol-1-yl]acetic acid is sourced from PubChem (CID 86717111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).