C23H20N2O3 — CID 22683212
2-[2-[4-(3,5-dimethylphenoxy)phenyl]benzimidazol-1-yl]acetic acid (PubChem CID 22683212) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[2-[4-(3,5-dimethylphenoxy)phenyl]benzimidazol-1-yl]acetic acid.
| Compound Name | 2-[2-[4-(3,5-dimethylphenoxy)phenyl]benzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 22683212 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-[2-[4-(3,5-dimethylphenoxy)phenyl]benzimidazol-1-yl]acetic acid |
| SMILES | Cc1cc(C)cc(Oc2ccc(-c3nc4ccccc4n3CC(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H20N2O3/c1-15-11-16(2)13-19(12-15)28-18-9-7-17(8-10-18)23-24-20-5-3-4-6-21(20)25(23)14-22(26)27/h3-13H,14H2,1-2H3,(H,26,27) |
| InChIKey | NHJWYTCAJZQDKC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |