C11H20N2OS — CID 79017643
N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethoxypropan-1-amine (PubChem CID 79017643) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethoxypropan-1-amine.
| Compound Name | N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 79017643 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethoxypropan-1-amine |
| SMILES | CCOCCCNCc1nc(C)c(C)s1 |
| InChI | InChI=1S/C11H20N2OS/c1-4-14-7-5-6-12-8-11-13-9(2)10(3)15-11/h12H,4-8H2,1-3H3 |
| InChIKey | XMZCWGNPCZJVGY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|