C13H16F2N2OS — CID 103148841
1-(1,3-benzothiazol-2-yl)-4-(2,2-difluoroethoxy)butan-2-amine (PubChem CID 103148841) has the molecular formula C13H16F2N2OS and a molecular weight of 286.35 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-4-(2,2-difluoroethoxy)butan-2-amine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-4-(2,2-difluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 103148841 |
| Molecular Formula | C13H16F2N2OS |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-4-(2,2-difluoroethoxy)butan-2-amine |
| SMILES | NC(CCOCC(F)F)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H16F2N2OS/c14-12(15)8-18-6-5-9(16)7-13-17-10-3-1-2-4-11(10)19-13/h1-4,9,12H,5-8,16H2 |
| InChIKey | VCXIFSQYSLEBGP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|