C16H14Cl2N2S — CID 79826359
1-(1,3-benzothiazol-2-yl)-3-(3,4-dichlorophenyl)propan-2-amine (PubChem CID 79826359) has the molecular formula C16H14Cl2N2S and a molecular weight of 337.28 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(3,4-dichlorophenyl)propan-2-amine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(3,4-dichlorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 79826359 |
| Molecular Formula | C16H14Cl2N2S |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(3,4-dichlorophenyl)propan-2-amine |
| SMILES | NC(Cc1ccc(Cl)c(Cl)c1)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14Cl2N2S/c17-12-6-5-10(8-13(12)18)7-11(19)9-16-20-14-3-1-2-4-15(14)21-16/h1-6,8,11H,7,9,19H2 |
| InChIKey | OYVTWLPLJPMWIP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |