C16H12FNO4S2 — CID 159570268
3-(1,3-benzothiazol-2-yl)-1-(2-fluorophenyl)-2-oxopropane-1-sulfonic acid (PubChem CID 159570268) has the molecular formula C16H12FNO4S2 and a molecular weight of 365.41 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1-(2-fluorophenyl)-2-oxopropane-1-sulfonic acid.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1-(2-fluorophenyl)-2-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 159570268 |
| Molecular Formula | C16H12FNO4S2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1-(2-fluorophenyl)-2-oxopropane-1-sulfonic acid |
| SMILES | O=C(Cc1nc2ccccc2s1)C(c1ccccc1F)S(=O)(=O)O |
| InChI | InChI=1S/C16H12FNO4S2/c17-11-6-2-1-5-10(11)16(24(20,21)22)13(19)9-15-18-12-7-3-4-8-14(12)23-15/h1-8,16H,9H2,(H,20,21,22) |
| InChIKey | MHSKYDVCXNSHTO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|