C17H16FN3OS — CID 42928256
1-(1,3-benzothiazol-2-ylmethyl)-3-[1-(2-fluorophenyl)ethyl]urea (PubChem CID 42928256) has the molecular formula C17H16FN3OS and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-3-[1-(2-fluorophenyl)ethyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-[1-(2-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 42928256 |
| Molecular Formula | C17H16FN3OS |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-[1-(2-fluorophenyl)ethyl]urea |
| SMILES | CC(NC(=O)NCc1nc2ccccc2s1)c1ccccc1F |
| InChI | InChI=1S/C17H16FN3OS/c1-11(12-6-2-3-7-13(12)18)20-17(22)19-10-16-21-14-8-4-5-9-15(14)23-16/h2-9,11H,10H2,1H3,(H2,19,20,22) |
| InChIKey | QEBBTNGKBWYQAB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |