C19H17NO4S — CID 7854998
1,3-benzothiazol-2-ylmethyl 2-(4-propanoylphenoxy)acetate (PubChem CID 7854998) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-(4-propanoylphenoxy)acetate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 7854998 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)OCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H17NO4S/c1-2-16(21)13-7-9-14(10-8-13)23-12-19(22)24-11-18-20-15-5-3-4-6-17(15)25-18/h3-10H,2,11-12H2,1H3 |
| InChIKey | MPWVFSHWVZPXKS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |