About (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate
(4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate (PubChem CID 30805310) has the molecular formula C20H17NO4
and a molecular weight of 335.36 g/mol. Its IUPAC name is (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate.
Molecular Properties
| Compound Name | (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate |
| PubChem CID | 30805310 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate |
| SMILES | Cc1ccc(OC(=O)COc2ccc(Oc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C20H17NO4/c1-15-5-7-18(8-6-15)25-20(22)14-23-16-9-11-17(12-10-16)24-19-4-2-3-13-21-19/h2-13H,14H2,1H3 |
| InChIKey | XXVAHTUGHMNSLD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate?
The IUPAC name of (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate (CID 30805310) is (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate.
What is the SMILES notation for (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate?
The canonical SMILES for (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate is Cc1ccc(OC(=O)COc2ccc(Oc3ccccn3)cc2)cc1.
What is the InChIKey of (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate?
The InChIKey is XXVAHTUGHMNSLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO4/c1-15-5-7-18(8-6-15)25-20(22)14-23-16-9-11-17(12-10-16)24-19-4-2-3-13-21-19/h2-13H,14H2,1H3.
What are the key properties of (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate?
(4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate has a molecular weight of 335.36 g/mol, XLogP of 4.17, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) 2-(4-pyridin-2-yloxyphenoxy)acetate is sourced from PubChem (CID 30805310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).