C24H22N4O3 — CID 112814343
N-[2-[(4-methylphenyl)methyl]pyrazol-3-yl]-2-(4-pyridin-2-yloxyphenoxy)acetamide (PubChem CID 112814343) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)methyl]pyrazol-3-yl]-2-(4-pyridin-2-yloxyphenoxy)acetamide.
| Compound Name | N-[2-[(4-methylphenyl)methyl]pyrazol-3-yl]-2-(4-pyridin-2-yloxyphenoxy)acetamide |
|---|---|
| PubChem CID | 112814343 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[2-[(4-methylphenyl)methyl]pyrazol-3-yl]-2-(4-pyridin-2-yloxyphenoxy)acetamide |
| SMILES | Cc1ccc(Cn2nccc2NC(=O)COc2ccc(Oc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-18-5-7-19(8-6-18)16-28-22(13-15-26-28)27-23(29)17-30-20-9-11-21(12-10-20)31-24-4-2-3-14-25-24/h2-15H,16-17H2,1H3,(H,27,29) |
| InChIKey | RCRVFKREBBQTAQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |