C18H15F3N2O3S — CID 52722170
3-(1,3-benzothiazol-2-yl)propyl 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate (PubChem CID 52722170) has the molecular formula C18H15F3N2O3S and a molecular weight of 396.39 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)propyl 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate.
| Compound Name | 3-(1,3-benzothiazol-2-yl)propyl 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 52722170 |
| Molecular Formula | C18H15F3N2O3S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)propyl 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylate |
| SMILES | O=C(OCCCc1nc2ccccc2s1)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C18H15F3N2O3S/c19-18(20,21)11-26-15-8-7-12(10-22-15)17(24)25-9-3-6-16-23-13-4-1-2-5-14(13)27-16/h1-2,4-5,7-8,10H,3,6,9,11H2 |
| InChIKey | BJRQHKMJXLWJSS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|