C20H17Cl2N3O2S — CID 134061546
(E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 134061546) has the molecular formula C20H17Cl2N3O2S and a molecular weight of 434.35 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 134061546 |
| Molecular Formula | C20H17Cl2N3O2S |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)/C=C/c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H17Cl2N3O2S/c1-2-25(12-17(26)24-20-13(21)6-5-7-14(20)22)19(27)11-10-18-23-15-8-3-4-9-16(15)28-18/h3-11H,2,12H2,1H3,(H,24,26)/b11-10+ |
| InChIKey | FYGRKVONFLBECX-ZHACJKMWSA-N |
| XLogP | 5.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|