C15H19NO2S2 — CID 60546140
1,3-benzothiazol-2-ylmethyl 2-butylsulfanylpropanoate (PubChem CID 60546140) has the molecular formula C15H19NO2S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-butylsulfanylpropanoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-butylsulfanylpropanoate |
|---|---|
| PubChem CID | 60546140 |
| Molecular Formula | C15H19NO2S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-butylsulfanylpropanoate |
| SMILES | CCCCSC(C)C(=O)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H19NO2S2/c1-3-4-9-19-11(2)15(17)18-10-14-16-12-7-5-6-8-13(12)20-14/h5-8,11H,3-4,9-10H2,1-2H3 |
| InChIKey | LORSKWQXSPOMNV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|