C15H19N3O3S — CID 7133814
1,3-benzothiazol-2-ylmethyl (2R)-2-(carbamoylamino)-4-methylpentanoate (PubChem CID 7133814) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl (2R)-2-(carbamoylamino)-4-methylpentanoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl (2R)-2-(carbamoylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 7133814 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl (2R)-2-(carbamoylamino)-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](NC(N)=O)C(=O)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H19N3O3S/c1-9(2)7-11(18-15(16)20)14(19)21-8-13-17-10-5-3-4-6-12(10)22-13/h3-6,9,11H,7-8H2,1-2H3,(H3,16,18,20)/t11-/m1/s1 |
| InChIKey | QAHWZIBKLXMESX-LLVKDONJSA-N |
| XLogP | 2.42 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |